In order to avoid security-related warning messages when switching to secured connection, you may want either to:
Click here to proceed.
| Name | Trifluoro-alanine |
| Molecular Weight [g/mol] | 144.07 |
| logP | -2.25 (predicted) |
| Sidechain logP | 0.64 |
| Volume [Å3 ] | 119.94 |
| Sidechain Volume [Å3 ] | 34.28 |
| pKa | 1.02 / 4.73 (predicted) |
| SMILES | [NH3][C@@H](C(F)(F)F)C(=O)O |
| D-amino acid code | DFLA ;(PDB: TDD) |
| PDB References: | |
| L-amino acid | PDB | Ligand |
| D-amino acid | PDB | Ligand |
| PubChem | |
| CAS number |