In order to avoid security-related warning messages when switching to secured connection, you may want either to:
Click here to proceed.
| Name | Norleucine |
| Molecular Weight [g/mol] | 131.17 |
| logP | -1.53 |
| Sidechain logP | 2.89 |
| Volume [Å3 ] | 171.92 |
| Sidechain Volume [Å3 ] | 86.26 |
| pKa | 2.79 / 9.53 (predicted) |
| SMILES | CCCC[C@@H]([C](=O)=O)[NH3] |
| D-amino acid code | DNLE ;(PDB: DNE) |
| PDB References: | |
| L-amino acid | PDB | Ligand |
| D-amino acid | PDB | Ligand |
| PubChem | L: 21236 | D: 456468 |
| CAS number | L: 327-57-1 | D: 327-56-0 |